C20H22O2Se — CID 12618580
[(2R,3R,4S,6S)-3-methyl-2,6-diphenylselenan-4-yl] acetate (PubChem CID 12618580) has the molecular formula C20H22O2Se and a molecular weight of 373.35 g/mol. Its IUPAC name is [(2R,3R,4S,6S)-3-methyl-2,6-diphenylselenan-4-yl] acetate.
| Compound Name | [(2R,3R,4S,6S)-3-methyl-2,6-diphenylselenan-4-yl] acetate |
|---|---|
| PubChem CID | 12618580 |
| Molecular Formula | C20H22O2Se |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | [(2R,3R,4S,6S)-3-methyl-2,6-diphenylselenan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](c2ccccc2)[Se][C@@H](c2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C20H22O2Se/c1-14-18(22-15(2)21)13-19(16-9-5-3-6-10-16)23-20(14)17-11-7-4-8-12-17/h3-12,14,18-20H,13H2,1-2H3/t14-,18+,19+,20-/m1/s1 |
| InChIKey | RUOXXJRXNMGBCS-QRKUABHPSA-N |
| XLogP | 4.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|