C21H24O2Se — CID 12618585
[(2R,3R,4S,6S)-3-ethyl-2,6-diphenylselenan-4-yl] acetate (PubChem CID 12618585) has the molecular formula C21H24O2Se and a molecular weight of 387.38 g/mol. Its IUPAC name is [(2R,3R,4S,6S)-3-ethyl-2,6-diphenylselenan-4-yl] acetate.
| Compound Name | [(2R,3R,4S,6S)-3-ethyl-2,6-diphenylselenan-4-yl] acetate |
|---|---|
| PubChem CID | 12618585 |
| Molecular Formula | C21H24O2Se |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | [(2R,3R,4S,6S)-3-ethyl-2,6-diphenylselenan-4-yl] acetate |
| SMILES | CC[C@@H]1[C@@H](OC(C)=O)C[C@@H](c2ccccc2)[Se][C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H24O2Se/c1-3-18-19(23-15(2)22)14-20(16-10-6-4-7-11-16)24-21(18)17-12-8-5-9-13-17/h4-13,18-21H,3,14H2,1-2H3/t18-,19+,20+,21+/m1/s1 |
| InChIKey | NQXALOIQNOJHON-ANULTFPQSA-N |
| XLogP | 4.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|