C12H14O2S — CID 170177717
[(2R,3R)-3-sulfanyl-1,2,3,4-tetrahydronaphthalen-2-yl] acetate (PubChem CID 170177717) has the molecular formula C12H14O2S and a molecular weight of 222.31 g/mol. Its IUPAC name is [(2R,3R)-3-sulfanyl-1,2,3,4-tetrahydronaphthalen-2-yl] acetate.
| Compound Name | [(2R,3R)-3-sulfanyl-1,2,3,4-tetrahydronaphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 170177717 |
| Molecular Formula | C12H14O2S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | [(2R,3R)-3-sulfanyl-1,2,3,4-tetrahydronaphthalen-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1Cc2ccccc2C[C@H]1S |
| InChI | InChI=1S/C12H14O2S/c1-8(13)14-11-6-9-4-2-3-5-10(9)7-12(11)15/h2-5,11-12,15H,6-7H2,1H3/t11-,12-/m1/s1 |
| InChIKey | GVCYRKUUYPSKED-VXGBXAGGSA-N |
| XLogP | 2.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|