C17H22O3Si — CID 134849753
[(1R,2S,3R,5R)-2-[dimethyl(phenyl)silyl]-6-oxo-3-bicyclo[3.2.0]heptanyl] acetate (PubChem CID 134849753) has the molecular formula C17H22O3Si and a molecular weight of 302.45 g/mol. Its IUPAC name is [(1R,2S,3R,5R)-2-[dimethyl(phenyl)silyl]-6-oxo-3-bicyclo[3.2.0]heptanyl] acetate.
| Compound Name | [(1R,2S,3R,5R)-2-[dimethyl(phenyl)silyl]-6-oxo-3-bicyclo[3.2.0]heptanyl] acetate |
|---|---|
| PubChem CID | 134849753 |
| Molecular Formula | C17H22O3Si |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [(1R,2S,3R,5R)-2-[dimethyl(phenyl)silyl]-6-oxo-3-bicyclo[3.2.0]heptanyl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H]2C(=O)C[C@H]2[C@@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C17H22O3Si/c1-11(18)20-16-10-13-14(9-15(13)19)17(16)21(2,3)12-7-5-4-6-8-12/h4-8,13-14,16-17H,9-10H2,1-3H3/t13-,14-,16-,17+/m1/s1 |
| InChIKey | PWCRGBDRXBGXAX-SRABZTEZSA-N |
| XLogP | 2.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|