C23H22O2 — CID 102064517
[(1S,4S,6R,7R)-8,9-diphenyl-4-tricyclo[4.3.0.03,7]non-8-enyl] acetate (PubChem CID 102064517) has the molecular formula C23H22O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is [(1S,4S,6R,7R)-8,9-diphenyl-4-tricyclo[4.3.0.03,7]non-8-enyl] acetate.
| Compound Name | [(1S,4S,6R,7R)-8,9-diphenyl-4-tricyclo[4.3.0.03,7]non-8-enyl] acetate |
|---|---|
| PubChem CID | 102064517 |
| Molecular Formula | C23H22O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | [(1S,4S,6R,7R)-8,9-diphenyl-4-tricyclo[4.3.0.03,7]non-8-enyl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H]2[C@@H]3CC1[C@@H]2C(c1ccccc1)=C3c1ccccc1 |
| InChI | InChI=1S/C23H22O2/c1-14(24)25-20-13-18-17-12-19(20)23(18)22(16-10-6-3-7-11-16)21(17)15-8-4-2-5-9-15/h2-11,17-20,23H,12-13H2,1H3/t17-,18+,19?,20-,23+/m0/s1 |
| InChIKey | IUPSONXLIKFMSA-RJMAJMSNSA-N |
| XLogP | 4.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|