C15H14O — CID 15674616
1-(3-phenyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)ethanone (PubChem CID 15674616) has the molecular formula C15H14O and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-(3-phenyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)ethanone.
| Compound Name | 1-(3-phenyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)ethanone |
|---|---|
| PubChem CID | 15674616 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 1-(3-phenyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)ethanone |
| SMILES | CC(=O)C1=C(c2ccccc2)C2C=CC1C2 |
| InChI | InChI=1S/C15H14O/c1-10(16)14-12-7-8-13(9-12)15(14)11-5-3-2-4-6-11/h2-8,12-13H,9H2,1H3 |
| InChIKey | UNEHANCGQJFLQS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|