C19H17NO3 — CID 10470463
[(4E)-4-hydroxyimino-2,3-diphenylcyclopent-2-en-1-yl] acetate (PubChem CID 10470463) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is [(4E)-4-hydroxyimino-2,3-diphenylcyclopent-2-en-1-yl] acetate.
| Compound Name | [(4E)-4-hydroxyimino-2,3-diphenylcyclopent-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 10470463 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | [(4E)-4-hydroxyimino-2,3-diphenylcyclopent-2-en-1-yl] acetate |
| SMILES | CC(=O)OC1C/C(=N\O)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C19H17NO3/c1-13(21)23-17-12-16(20-22)18(14-8-4-2-5-9-14)19(17)15-10-6-3-7-11-15/h2-11,17,22H,12H2,1H3/b20-16+ |
| InChIKey | QJKDXOHEUKVBOU-CAPFRKAQSA-N |
| XLogP | 3.76 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|