C21H28O4 — CID 11089230
methyl 4-[(3R,5S)-5-acetyloxy-2-methyl-3-phenylcyclopenten-1-yl]-4-methylpentanoate (PubChem CID 11089230) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is methyl 4-[(3R,5S)-5-acetyloxy-2-methyl-3-phenylcyclopenten-1-yl]-4-methylpentanoate.
| Compound Name | methyl 4-[(3R,5S)-5-acetyloxy-2-methyl-3-phenylcyclopenten-1-yl]-4-methylpentanoate |
|---|---|
| PubChem CID | 11089230 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | methyl 4-[(3R,5S)-5-acetyloxy-2-methyl-3-phenylcyclopenten-1-yl]-4-methylpentanoate |
| SMILES | COC(=O)CCC(C)(C)C1=C(C)[C@@H](c2ccccc2)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H28O4/c1-14-17(16-9-7-6-8-10-16)13-18(25-15(2)22)20(14)21(3,4)12-11-19(23)24-5/h6-10,17-18H,11-13H2,1-5H3/t17-,18-/m0/s1 |
| InChIKey | UDKALYRUAUIXJH-ROUUACIJSA-N |
| XLogP | 4.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|