C19H25BrO3 — CID 11760709
[(1R,5R)-5-[(2S)-1-bromo-2-methoxypropan-2-yl]-2-methyl-3-phenylcyclohex-2-en-1-yl] acetate (PubChem CID 11760709) has the molecular formula C19H25BrO3 and a molecular weight of 381.31 g/mol. Its IUPAC name is [(1R,5R)-5-[(2S)-1-bromo-2-methoxypropan-2-yl]-2-methyl-3-phenylcyclohex-2-en-1-yl] acetate.
| Compound Name | [(1R,5R)-5-[(2S)-1-bromo-2-methoxypropan-2-yl]-2-methyl-3-phenylcyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 11760709 |
| Molecular Formula | C19H25BrO3 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | [(1R,5R)-5-[(2S)-1-bromo-2-methoxypropan-2-yl]-2-methyl-3-phenylcyclohex-2-en-1-yl] acetate |
| SMILES | CO[C@](C)(CBr)[C@@H]1CC(c2ccccc2)=C(C)[C@H](OC(C)=O)C1 |
| InChI | InChI=1S/C19H25BrO3/c1-13-17(15-8-6-5-7-9-15)10-16(19(3,12-20)22-4)11-18(13)23-14(2)21/h5-9,16,18H,10-12H2,1-4H3/t16-,18-,19-/m1/s1 |
| InChIKey | RFGIYJHJPRFNPX-BHIYHBOVSA-N |
| XLogP | 4.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|