C20H22O3 — CID 38361315
[(1R,2R,3R,6R)-2-hydroxy-3,6-diphenylcyclohexyl] acetate (PubChem CID 38361315) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is [(1R,2R,3R,6R)-2-hydroxy-3,6-diphenylcyclohexyl] acetate.
| Compound Name | [(1R,2R,3R,6R)-2-hydroxy-3,6-diphenylcyclohexyl] acetate |
|---|---|
| PubChem CID | 38361315 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | [(1R,2R,3R,6R)-2-hydroxy-3,6-diphenylcyclohexyl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](O)[C@@H](c2ccccc2)CC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H22O3/c1-14(21)23-20-18(16-10-6-3-7-11-16)13-12-17(19(20)22)15-8-4-2-5-9-15/h2-11,17-20,22H,12-13H2,1H3/t17-,18-,19-,20-/m1/s1 |
| InChIKey | RRGRXDIGPVAQIW-UAFMIMERSA-N |
| XLogP | 3.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |