C13H20OSi — CID 10013756
cis-(1S,3R)-3-[dimethyl(phenyl)silyl]cyclopentan-1-ol (PubChem CID 10013756) has the molecular formula C13H20OSi and a molecular weight of 220.39 g/mol. Its IUPAC name is cis-(1S,3R)-3-[dimethyl(phenyl)silyl]cyclopentan-1-ol.
| Compound Name | cis-(1S,3R)-3-[dimethyl(phenyl)silyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 10013756 |
| Molecular Formula | C13H20OSi |
| Molecular Weight | 220.39 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | cis-(1S,3R)-3-[dimethyl(phenyl)silyl]cyclopentan-1-ol |
| SMILES | C[Si](C)(c1ccccc1)[C@@H]1CC[C@H](O)C1 |
| InChI | InChI=1S/C13H20OSi/c1-15(2,12-6-4-3-5-7-12)13-9-8-11(14)10-13/h3-7,11,13-14H,8-10H2,1-2H3/t11-,13+/m0/s1 |
| InChIKey | DSJYCEUQMJDOQB-WCQYABFASA-N |
| XLogP | 2.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|