C15H24OSi — CID 101071423
dimethyl-phenyl-[(2R,3S)-2,5,5-trimethyloxolan-3-yl]silane (PubChem CID 101071423) has the molecular formula C15H24OSi and a molecular weight of 248.44 g/mol. Its IUPAC name is dimethyl-phenyl-[(2R,3S)-2,5,5-trimethyloxolan-3-yl]silane.
| Compound Name | dimethyl-phenyl-[(2R,3S)-2,5,5-trimethyloxolan-3-yl]silane |
|---|---|
| PubChem CID | 101071423 |
| Molecular Formula | C15H24OSi |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | dimethyl-phenyl-[(2R,3S)-2,5,5-trimethyloxolan-3-yl]silane |
| SMILES | C[C@H]1OC(C)(C)C[C@@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C15H24OSi/c1-12-14(11-15(2,3)16-12)17(4,5)13-9-7-6-8-10-13/h6-10,12,14H,11H2,1-5H3/t12-,14+/m1/s1 |
| InChIKey | LTQQHRLYKBCGPM-OCCSQVGLSA-N |
| XLogP | 3.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|