C22H28Si — CID 139263743
[(2E)-2-benzylidene-4,4-dimethylcyclopentyl]-dimethyl-phenylsilane (PubChem CID 139263743) has the molecular formula C22H28Si and a molecular weight of 320.55 g/mol. Its IUPAC name is [(2E)-2-benzylidene-4,4-dimethylcyclopentyl]-dimethyl-phenylsilane.
| Compound Name | [(2E)-2-benzylidene-4,4-dimethylcyclopentyl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 139263743 |
| Molecular Formula | C22H28Si |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | [(2E)-2-benzylidene-4,4-dimethylcyclopentyl]-dimethyl-phenylsilane |
| SMILES | CC1(C)C/C(=C\c2ccccc2)C([Si](C)(C)c2ccccc2)C1 |
| InChI | InChI=1S/C22H28Si/c1-22(2)16-19(15-18-11-7-5-8-12-18)21(17-22)23(3,4)20-13-9-6-10-14-20/h5-15,21H,16-17H2,1-4H3/b19-15+ |
| InChIKey | POCYEQXJBQVCEC-XDJHFCHBSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|