C19H21NO — CID 174523969
7,7-dimethyl-2-(2-phenylethenyl)-6,8-dihydro-5H-quinolin-5-ol (PubChem CID 174523969) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 7,7-dimethyl-2-(2-phenylethenyl)-6,8-dihydro-5H-quinolin-5-ol.
| Compound Name | 7,7-dimethyl-2-(2-phenylethenyl)-6,8-dihydro-5H-quinolin-5-ol |
|---|---|
| PubChem CID | 174523969 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 7,7-dimethyl-2-(2-phenylethenyl)-6,8-dihydro-5H-quinolin-5-ol |
| SMILES | CC1(C)Cc2nc(C=Cc3ccccc3)ccc2C(O)C1 |
| InChI | InChI=1S/C19H21NO/c1-19(2)12-17-16(18(21)13-19)11-10-15(20-17)9-8-14-6-4-3-5-7-14/h3-11,18,21H,12-13H2,1-2H3 |
| InChIKey | LGOKDPXEXWRBPM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |