C22H25NO2 — CID 10359964
[(2E)-2-benzylidene-4,4-dimethylcyclohexyl] N-phenylcarbamate (PubChem CID 10359964) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is [(2E)-2-benzylidene-4,4-dimethylcyclohexyl] N-phenylcarbamate.
| Compound Name | [(2E)-2-benzylidene-4,4-dimethylcyclohexyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 10359964 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | [(2E)-2-benzylidene-4,4-dimethylcyclohexyl] N-phenylcarbamate |
| SMILES | CC1(C)CCC(OC(=O)Nc2ccccc2)/C(=C/c2ccccc2)C1 |
| InChI | InChI=1S/C22H25NO2/c1-22(2)14-13-20(18(16-22)15-17-9-5-3-6-10-17)25-21(24)23-19-11-7-4-8-12-19/h3-12,15,20H,13-14,16H2,1-2H3,(H,23,24)/b18-15+ |
| InChIKey | MVTGSAYZSHJXJC-OBGWFSINSA-N |
| XLogP | 5.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |