C16H20O2 — CID 10421928
[(5E)-5-benzylidene-2,2-dimethylcyclopentyl] acetate (PubChem CID 10421928) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is [(5E)-5-benzylidene-2,2-dimethylcyclopentyl] acetate.
| Compound Name | [(5E)-5-benzylidene-2,2-dimethylcyclopentyl] acetate |
|---|---|
| PubChem CID | 10421928 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | [(5E)-5-benzylidene-2,2-dimethylcyclopentyl] acetate |
| SMILES | CC(=O)OC1/C(=C/c2ccccc2)CCC1(C)C |
| InChI | InChI=1S/C16H20O2/c1-12(17)18-15-14(9-10-16(15,2)3)11-13-7-5-4-6-8-13/h4-8,11,15H,9-10H2,1-3H3/b14-11+ |
| InChIKey | QFBVXBZPEOSTNX-SDNWHVSQSA-N |
| XLogP | 3.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |