C18H26OSi — CID 102403651
(1S,2E,3S,5R)-2-benzylidene-4,4-dimethyl-1-trimethylsilylbicyclo[3.1.0]hexan-3-ol (PubChem CID 102403651) has the molecular formula C18H26OSi and a molecular weight of 286.49 g/mol. Its IUPAC name is (1S,2E,3S,5R)-2-benzylidene-4,4-dimethyl-1-trimethylsilylbicyclo[3.1.0]hexan-3-ol.
| Compound Name | (1S,2E,3S,5R)-2-benzylidene-4,4-dimethyl-1-trimethylsilylbicyclo[3.1.0]hexan-3-ol |
|---|---|
| PubChem CID | 102403651 |
| Molecular Formula | C18H26OSi |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (1S,2E,3S,5R)-2-benzylidene-4,4-dimethyl-1-trimethylsilylbicyclo[3.1.0]hexan-3-ol |
| SMILES | CC1(C)[C@H](O)/C(=C\c2ccccc2)[C@]2([Si](C)(C)C)C[C@H]12 |
| InChI | InChI=1S/C18H26OSi/c1-17(2)15-12-18(15,20(3,4)5)14(16(17)19)11-13-9-7-6-8-10-13/h6-11,15-16,19H,12H2,1-5H3/b14-11+/t15-,16-,18-/m1/s1 |
| InChIKey | GAYOACHZJZRQDU-KUYLTSQGSA-N |
| XLogP | 4.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|