C16H18O2 — CID 101066852
methyl (2E)-2-[(2Z)-2-benzylidenecyclohexylidene]acetate (PubChem CID 101066852) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-benzylidenecyclohexylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-benzylidenecyclohexylidene]acetate |
|---|---|
| PubChem CID | 101066852 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-benzylidenecyclohexylidene]acetate |
| SMILES | COC(=O)/C=C1\CCCC\C1=C\c1ccccc1 |
| InChI | InChI=1S/C16H18O2/c1-18-16(17)12-15-10-6-5-9-14(15)11-13-7-3-2-4-8-13/h2-4,7-8,11-12H,5-6,9-10H2,1H3/b14-11-,15-12+ |
| InChIKey | GINREBDSODUNEH-KMUHKHSISA-N |
| XLogP | 3.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|