C11H12O3 — CID 115466743
methyl (2Z)-2-(6,7-dihydro-5H-1-benzofuran-4-ylidene)acetate (PubChem CID 115466743) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is methyl (2Z)-2-(6,7-dihydro-5H-1-benzofuran-4-ylidene)acetate.
| Compound Name | methyl (2Z)-2-(6,7-dihydro-5H-1-benzofuran-4-ylidene)acetate |
|---|---|
| PubChem CID | 115466743 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | methyl (2Z)-2-(6,7-dihydro-5H-1-benzofuran-4-ylidene)acetate |
| SMILES | COC(=O)/C=C1/CCCc2occc21 |
| InChI | InChI=1S/C11H12O3/c1-13-11(12)7-8-3-2-4-10-9(8)5-6-14-10/h5-7H,2-4H2,1H3/b8-7- |
| InChIKey | FOTWKAGAEJSJLN-FPLPWBNLSA-N |
| XLogP | 2.17 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|