C9H11NO2 — CID 126997465
(Z)-N-methoxy-6,7-dihydro-5H-1-benzofuran-4-imine (PubChem CID 126997465) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is (Z)-N-methoxy-6,7-dihydro-5H-1-benzofuran-4-imine.
| Compound Name | (Z)-N-methoxy-6,7-dihydro-5H-1-benzofuran-4-imine |
|---|---|
| PubChem CID | 126997465 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (Z)-N-methoxy-6,7-dihydro-5H-1-benzofuran-4-imine |
| SMILES | CO/N=C1/CCCc2occc21 |
| InChI | InChI=1S/C9H11NO2/c1-11-10-8-3-2-4-9-7(8)5-6-12-9/h5-6H,2-4H2,1H3/b10-8- |
| InChIKey | NDTYWISRISCCSI-NTMALXAHSA-N |
| XLogP | 1.97 |
| TPSA | 34.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|