C11H20O — CID 91348632
5,6-dihydro-4H-cyclopenta[b]furan;ethane (PubChem CID 91348632) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is 5,6-dihydro-4H-cyclopenta[b]furan;ethane.
| Compound Name | 5,6-dihydro-4H-cyclopenta[b]furan;ethane |
|---|---|
| PubChem CID | 91348632 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 5,6-dihydro-4H-cyclopenta[b]furan;ethane |
| SMILES | CC.CC.c1cc2c(o1)CCC2 |
| InChI | InChI=1S/C7H8O.2C2H6/c1-2-6-4-5-8-7(6)3-1;2*1-2/h4-5H,1-3H2;2*1-2H3 |
| InChIKey | KNNQRVNKKBBHTG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |