C10H12O — CID 142194982
acetylene;4,5,6,7-tetrahydro-1-benzofuran (PubChem CID 142194982) has the molecular formula C10H12O and a molecular weight of 148.20 g/mol. Its IUPAC name is acetylene;4,5,6,7-tetrahydro-1-benzofuran.
| Compound Name | acetylene;4,5,6,7-tetrahydro-1-benzofuran |
|---|---|
| PubChem CID | 142194982 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | acetylene;4,5,6,7-tetrahydro-1-benzofuran |
| SMILES | C#C.c1cc2c(o1)CCCC2 |
| InChI | InChI=1S/C8H10O.C2H2/c1-2-4-8-7(3-1)5-6-9-8;1-2/h5-6H,1-4H2;1-2H |
| InChIKey | NMAAPBCOPGBFPV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|