C12H13NO3 — CID 1477741
(6,7-dihydro-5H-1-benzofuran-4-ylideneamino) cyclopropanecarboxylate (PubChem CID 1477741) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is (6,7-dihydro-5H-1-benzofuran-4-ylideneamino) cyclopropanecarboxylate.
| Compound Name | (6,7-dihydro-5H-1-benzofuran-4-ylideneamino) cyclopropanecarboxylate |
|---|---|
| PubChem CID | 1477741 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (6,7-dihydro-5H-1-benzofuran-4-ylideneamino) cyclopropanecarboxylate |
| SMILES | O=C(ON=C1CCCc2occc21)C1CC1 |
| InChI | InChI=1S/C12H13NO3/c14-12(8-4-5-8)16-13-10-2-1-3-11-9(10)6-7-15-11/h6-8H,1-5H2 |
| InChIKey | QGKAIRNBQRQXOS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|