C10H10O4 — CID 11310068
methyl 4-oxo-6,7-dihydro-5H-1-benzofuran-5-carboxylate (PubChem CID 11310068) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is methyl 4-oxo-6,7-dihydro-5H-1-benzofuran-5-carboxylate.
| Compound Name | methyl 4-oxo-6,7-dihydro-5H-1-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 11310068 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | methyl 4-oxo-6,7-dihydro-5H-1-benzofuran-5-carboxylate |
| SMILES | COC(=O)C1CCc2occc2C1=O |
| InChI | InChI=1S/C10H10O4/c1-13-10(12)7-2-3-8-6(9(7)11)4-5-14-8/h4-5,7H,2-3H2,1H3 |
| InChIKey | DEIFTKOOBRKBBF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|