C9H8O3 — CID 174943247
6,7-dihydro-1-benzofuran-4-carboxylic acid (PubChem CID 174943247) has the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. Its IUPAC name is 6,7-dihydro-1-benzofuran-4-carboxylic acid.
| Compound Name | 6,7-dihydro-1-benzofuran-4-carboxylic acid |
|---|---|
| PubChem CID | 174943247 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 6,7-dihydro-1-benzofuran-4-carboxylic acid |
| SMILES | O=C(O)C1=CCCc2occc21 |
| InChI | InChI=1S/C9H8O3/c10-9(11)7-2-1-3-8-6(7)4-5-12-8/h2,4-5H,1,3H2,(H,10,11) |
| InChIKey | YWHZPGKSOBDYNR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |