C16H10BrNO3 — CID 115466648
8-bromo-4,5-dihydrofuro[2,3-c]acridine-6-carboxylic acid (PubChem CID 115466648) has the molecular formula C16H10BrNO3 and a molecular weight of 344.16 g/mol. Its IUPAC name is 8-bromo-4,5-dihydrofuro[2,3-c]acridine-6-carboxylic acid.
| Compound Name | 8-bromo-4,5-dihydrofuro[2,3-c]acridine-6-carboxylic acid |
|---|---|
| PubChem CID | 115466648 |
| Molecular Formula | C16H10BrNO3 |
| Molecular Weight | 344.16 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 8-bromo-4,5-dihydrofuro[2,3-c]acridine-6-carboxylic acid |
| SMILES | O=C(O)c1c2c(nc3ccc(Br)cc13)-c1ccoc1CC2 |
| InChI | InChI=1S/C16H10BrNO3/c17-8-1-3-12-11(7-8)14(16(19)20)10-2-4-13-9(5-6-21-13)15(10)18-12/h1,3,5-7H,2,4H2,(H,19,20) |
| InChIKey | HXTZBDHCQHLABX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.16 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |