C21H18O — CID 174839163
bis(3,4-dihydronaphthalen-1-yl)methanone (PubChem CID 174839163) has the molecular formula C21H18O and a molecular weight of 286.37 g/mol. Its IUPAC name is bis(3,4-dihydronaphthalen-1-yl)methanone.
| Compound Name | bis(3,4-dihydronaphthalen-1-yl)methanone |
|---|---|
| PubChem CID | 174839163 |
| Molecular Formula | C21H18O |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | bis(3,4-dihydronaphthalen-1-yl)methanone |
| SMILES | O=C(C1=CCCc2ccccc21)C1=CCCc2ccccc21 |
| InChI | InChI=1S/C21H18O/c22-21(19-13-5-9-15-7-1-3-11-17(15)19)20-14-6-10-16-8-2-4-12-18(16)20/h1-4,7-8,11-14H,5-6,9-10H2 |
| InChIKey | PPUFQICKASTYAB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |