About benzene;N-(3,4-dihydronaphthalen-1-yl)acetamide
benzene;N-(3,4-dihydronaphthalen-1-yl)acetamide (PubChem CID 159354733) has the molecular formula C18H19NO
and a molecular weight of 265.36 g/mol. Its IUPAC name is benzene;N-(3,4-dihydronaphthalen-1-yl)acetamide.
Molecular Properties
| Compound Name | benzene;N-(3,4-dihydronaphthalen-1-yl)acetamide |
| PubChem CID | 159354733 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | benzene;N-(3,4-dihydronaphthalen-1-yl)acetamide |
| SMILES | CC(=O)NC1=CCCc2ccccc21.c1ccccc1 |
| InChI | InChI=1S/C12H13NO.C6H6/c1-9(14)13-12-8-4-6-10-5-2-3-7-11(10)12;1-2-4-6-5-3-1/h2-3,5,7-8H,4,6H2,1H3,(H,13,14);1-6H |
| InChIKey | LHTXYSZKBBUSBE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzene;N-(3,4-dihydronaphthalen-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;N-(3,4-dihydronaphthalen-1-yl)acetamide?
The IUPAC name of benzene;N-(3,4-dihydronaphthalen-1-yl)acetamide (CID 159354733) is benzene;N-(3,4-dihydronaphthalen-1-yl)acetamide.
What is the SMILES notation for benzene;N-(3,4-dihydronaphthalen-1-yl)acetamide?
The canonical SMILES for benzene;N-(3,4-dihydronaphthalen-1-yl)acetamide is CC(=O)NC1=CCCc2ccccc21.c1ccccc1.
What is the InChIKey of benzene;N-(3,4-dihydronaphthalen-1-yl)acetamide?
The InChIKey is LHTXYSZKBBUSBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO.C6H6/c1-9(14)13-12-8-4-6-10-5-2-3-7-11(10)12;1-2-4-6-5-3-1/h2-3,5,7-8H,4,6H2,1H3,(H,13,14);1-6H.
What are the key properties of benzene;N-(3,4-dihydronaphthalen-1-yl)acetamide?
benzene;N-(3,4-dihydronaphthalen-1-yl)acetamide has a molecular weight of 265.36 g/mol, XLogP of 3.80, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;N-(3,4-dihydronaphthalen-1-yl)acetamide is sourced from PubChem (CID 159354733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).