C18H19NO — CID 159354733
benzene;N-(3,4-dihydronaphthalen-1-yl)acetamide (PubChem CID 159354733) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is benzene;N-(3,4-dihydronaphthalen-1-yl)acetamide.
| Compound Name | benzene;N-(3,4-dihydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 159354733 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | benzene;N-(3,4-dihydronaphthalen-1-yl)acetamide |
| SMILES | CC(=O)NC1=CCCc2ccccc21.c1ccccc1 |
| InChI | InChI=1S/C12H13NO.C6H6/c1-9(14)13-12-8-4-6-10-5-2-3-7-11(10)12;1-2-4-6-5-3-1/h2-3,5,7-8H,4,6H2,1H3,(H,13,14);1-6H |
| InChIKey | LHTXYSZKBBUSBE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |