C11H12N2O — CID 142857386
3,4-dihydronaphthalen-1-ylurea (PubChem CID 142857386) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 3,4-dihydronaphthalen-1-ylurea.
| Compound Name | 3,4-dihydronaphthalen-1-ylurea |
|---|---|
| PubChem CID | 142857386 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 3,4-dihydronaphthalen-1-ylurea |
| SMILES | NC(=O)NC1=CCCc2ccccc21 |
| InChI | InChI=1S/C11H12N2O/c12-11(14)13-10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6-7H,3,5H2,(H3,12,13,14) |
| InChIKey | LWLDUCYFZSXNBP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |