C15H13BrN2O2 — CID 2170922
5-bromo-N'-(3,4-dihydronaphthalen-1-yl)furan-2-carbohydrazide (PubChem CID 2170922) has the molecular formula C15H13BrN2O2 and a molecular weight of 333.19 g/mol. Its IUPAC name is 5-bromo-N'-(3,4-dihydronaphthalen-1-yl)furan-2-carbohydrazide.
| Compound Name | 5-bromo-N'-(3,4-dihydronaphthalen-1-yl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 2170922 |
| Molecular Formula | C15H13BrN2O2 |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 5-bromo-N'-(3,4-dihydronaphthalen-1-yl)furan-2-carbohydrazide |
| SMILES | O=C(NNC1=CCCc2ccccc21)c1ccc(Br)o1 |
| InChI | InChI=1S/C15H13BrN2O2/c16-14-9-8-13(20-14)15(19)18-17-12-7-3-5-10-4-1-2-6-11(10)12/h1-2,4,6-9,17H,3,5H2,(H,18,19) |
| InChIKey | HXCMNMGYYCHKBW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|