C12H10BrN3O2 — CID 4745345
5-bromo-N'-(1-pyridin-4-ylethenyl)furan-2-carbohydrazide (PubChem CID 4745345) has the molecular formula C12H10BrN3O2 and a molecular weight of 308.14 g/mol. Its IUPAC name is 5-bromo-N'-(1-pyridin-4-ylethenyl)furan-2-carbohydrazide.
| Compound Name | 5-bromo-N'-(1-pyridin-4-ylethenyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 4745345 |
| Molecular Formula | C12H10BrN3O2 |
| Molecular Weight | 308.14 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 5-bromo-N'-(1-pyridin-4-ylethenyl)furan-2-carbohydrazide |
| SMILES | C=C(NNC(=O)c1ccc(Br)o1)c1ccncc1 |
| InChI | InChI=1S/C12H10BrN3O2/c1-8(9-4-6-14-7-5-9)15-16-12(17)10-2-3-11(13)18-10/h2-7,15H,1H2,(H,16,17) |
| InChIKey | ZZYWBZTUFNGJJA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.14 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|