C14H15BrN2O5 — CID 51017946
(1S,2R,3S,4S)-3-[[(5-bromofuran-2-carbonyl)amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 51017946) has the molecular formula C14H15BrN2O5 and a molecular weight of 371.19 g/mol. Its IUPAC name is (1S,2R,3S,4S)-3-[[(5-bromofuran-2-carbonyl)amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1S,2R,3S,4S)-3-[[(5-bromofuran-2-carbonyl)amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 51017946 |
| Molecular Formula | C14H15BrN2O5 |
| Molecular Weight | 371.19 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | (1S,2R,3S,4S)-3-[[(5-bromofuran-2-carbonyl)amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | O=C(NNC(=O)[C@H]1[C@H]2CC[C@@H](C2)[C@H]1C(=O)O)c1ccc(Br)o1 |
| InChI | InChI=1S/C14H15BrN2O5/c15-9-4-3-8(22-9)12(18)16-17-13(19)10-6-1-2-7(5-6)11(10)14(20)21/h3-4,6-7,10-11H,1-2,5H2,(H,16,18)(H,17,19)(H,20,21)/t6-,7-,10-,11+/m0/s1 |
| InChIKey | DEVBDPVDCFRFSB-AGNRWKBWSA-N |
| XLogP | 1.55 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.19 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|