C13H14BrN2O5- — CID 7310004
trans-(1R,2R)-2-[[(5-bromofuran-2-carbonyl)amino]carbamoyl]cyclohexane-1-carboxylate (PubChem CID 7310004) has the molecular formula C13H14BrN2O5- and a molecular weight of 358.17 g/mol. Its IUPAC name is trans-(1R,2R)-2-[[(5-bromofuran-2-carbonyl)amino]carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | trans-(1R,2R)-2-[[(5-bromofuran-2-carbonyl)amino]carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 7310004 |
| Molecular Formula | C13H14BrN2O5- |
| Molecular Weight | 358.17 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | trans-(1R,2R)-2-[[(5-bromofuran-2-carbonyl)amino]carbamoyl]cyclohexane-1-carboxylate |
| SMILES | O=C(NNC(=O)[C@@H]1CCCC[C@H]1C(=O)[O-])c1ccc(Br)o1 |
| InChI | InChI=1S/C13H15BrN2O5/c14-10-6-5-9(21-10)12(18)16-15-11(17)7-3-1-2-4-8(7)13(19)20/h5-8H,1-4H2,(H,15,17)(H,16,18)(H,19,20)/p-1/t7-,8-/m1/s1 |
| InChIKey | PDMGKIBLBKTJEC-HTQZYQBOSA-M |
| XLogP | 0.36 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.17 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|