C16H18N3O6- — CID 6949246
trans-(1R,2R)-2-[[(3-methyl-4-nitrobenzoyl)amino]carbamoyl]cyclohexane-1-carboxylate (PubChem CID 6949246) has the molecular formula C16H18N3O6- and a molecular weight of 348.34 g/mol. Its IUPAC name is trans-(1R,2R)-2-[[(3-methyl-4-nitrobenzoyl)amino]carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | trans-(1R,2R)-2-[[(3-methyl-4-nitrobenzoyl)amino]carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 6949246 |
| Molecular Formula | C16H18N3O6- |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | trans-(1R,2R)-2-[[(3-methyl-4-nitrobenzoyl)amino]carbamoyl]cyclohexane-1-carboxylate |
| SMILES | Cc1cc(C(=O)NNC(=O)[C@@H]2CCCC[C@H]2C(=O)[O-])ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19N3O6/c1-9-8-10(6-7-13(9)19(24)25)14(20)17-18-15(21)11-4-2-3-5-12(11)16(22)23/h6-8,11-12H,2-5H2,1H3,(H,17,20)(H,18,21)(H,22,23)/p-1/t11-,12-/m1/s1 |
| InChIKey | BPMRHYNJSRZFHK-VXGBXAGGSA-M |
| XLogP | 0.22 |
| TPSA | 141.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|