C14H20ClN3O3 — CID 119476972
N-(4-aminocyclohexyl)-3-methyl-4-nitrobenzamide;hydrochloride (PubChem CID 119476972) has the molecular formula C14H20ClN3O3 and a molecular weight of 313.79 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-3-methyl-4-nitrobenzamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-3-methyl-4-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119476972 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-(4-aminocyclohexyl)-3-methyl-4-nitrobenzamide;hydrochloride |
| SMILES | Cc1cc(C(=O)NC2CCC(N)CC2)ccc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C14H19N3O3.ClH/c1-9-8-10(2-7-13(9)17(19)20)14(18)16-12-5-3-11(15)4-6-12;/h2,7-8,11-12H,3-6,15H2,1H3,(H,16,18);1H |
| InChIKey | JERSCACAAGMYIA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|