C12H16BrNO2 — CID 55028748
5-bromo-N-(2-cyclopentylethyl)furan-2-carboxamide (PubChem CID 55028748) has the molecular formula C12H16BrNO2 and a molecular weight of 286.17 g/mol. Its IUPAC name is 5-bromo-N-(2-cyclopentylethyl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(2-cyclopentylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 55028748 |
| Molecular Formula | C12H16BrNO2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 5-bromo-N-(2-cyclopentylethyl)furan-2-carboxamide |
| SMILES | O=C(NCCC1CCCC1)c1ccc(Br)o1 |
| InChI | InChI=1S/C12H16BrNO2/c13-11-6-5-10(16-11)12(15)14-8-7-9-3-1-2-4-9/h5-6,9H,1-4,7-8H2,(H,14,15) |
| InChIKey | XQJLVMFZVXVCSS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |