C18H18BrN3O2 — CID 1048509
5-bromo-N'-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylfuran-2-carbohydrazide (PubChem CID 1048509) has the molecular formula C18H18BrN3O2 and a molecular weight of 388.27 g/mol. Its IUPAC name is 5-bromo-N'-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylfuran-2-carbohydrazide.
| Compound Name | 5-bromo-N'-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylfuran-2-carbohydrazide |
|---|---|
| PubChem CID | 1048509 |
| Molecular Formula | C18H18BrN3O2 |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 5-bromo-N'-spiro[4H-isoquinoline-3,1'-cyclopentane]-1-ylfuran-2-carbohydrazide |
| SMILES | O=C(NNC1=NC2(CCCC2)Cc2ccccc21)c1ccc(Br)o1 |
| InChI | InChI=1S/C18H18BrN3O2/c19-15-8-7-14(24-15)17(23)22-21-16-13-6-2-1-5-12(13)11-18(20-16)9-3-4-10-18/h1-2,5-8H,3-4,9-11H2,(H,20,21)(H,22,23) |
| InChIKey | HZBPXHNJTRUDCH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|