C18H18N4O3 — CID 3100283
N'-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-nitrobenzohydrazide (PubChem CID 3100283) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is N'-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-nitrobenzohydrazide.
| Compound Name | N'-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-nitrobenzohydrazide |
|---|---|
| PubChem CID | 3100283 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N'-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-nitrobenzohydrazide |
| SMILES | CC1(C)Cc2ccccc2C(NNC(=O)c2ccccc2[N+](=O)[O-])=N1 |
| InChI | InChI=1S/C18H18N4O3/c1-18(2)11-12-7-3-4-8-13(12)16(19-18)20-21-17(23)14-9-5-6-10-15(14)22(24)25/h3-10H,11H2,1-2H3,(H,19,20)(H,21,23) |
| InChIKey | CKNNLOZTXPTTFX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 96.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|