C12H16FN — CID 144557544
fluoromethane;N-methyl-3,4-dihydronaphthalen-1-amine (PubChem CID 144557544) has the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. Its IUPAC name is fluoromethane;N-methyl-3,4-dihydronaphthalen-1-amine.
| Compound Name | fluoromethane;N-methyl-3,4-dihydronaphthalen-1-amine |
|---|---|
| PubChem CID | 144557544 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | fluoromethane;N-methyl-3,4-dihydronaphthalen-1-amine |
| SMILES | CF.CNC1=CCCc2ccccc21 |
| InChI | InChI=1S/C11H13N.CH3F/c1-12-11-8-4-6-9-5-2-3-7-10(9)11;1-2/h2-3,5,7-8,12H,4,6H2,1H3;1H3 |
| InChIKey | XNXRJEWHKZLSKK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |