About N-methyl-1,2-dihydroisoquinolin-4-amine
N-methyl-1,2-dihydroisoquinolin-4-amine (PubChem CID 166944414) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is N-methyl-1,2-dihydroisoquinolin-4-amine.
Molecular Properties
| Compound Name | N-methyl-1,2-dihydroisoquinolin-4-amine |
| PubChem CID | 166944414 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | N-methyl-1,2-dihydroisoquinolin-4-amine |
| SMILES | CNC1=CNCc2ccccc21 |
| InChI | InChI=1S/C10H12N2/c1-11-10-7-12-6-8-4-2-3-5-9(8)10/h2-5,7,11-12H,6H2,1H3 |
| InChIKey | RQDAVWYGUJLPAT-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-1,2-dihydroisoquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1,2-dihydroisoquinolin-4-amine?
The IUPAC name of N-methyl-1,2-dihydroisoquinolin-4-amine (CID 166944414) is N-methyl-1,2-dihydroisoquinolin-4-amine.
What is the SMILES notation for N-methyl-1,2-dihydroisoquinolin-4-amine?
The canonical SMILES for N-methyl-1,2-dihydroisoquinolin-4-amine is CNC1=CNCc2ccccc21.
What is the InChIKey of N-methyl-1,2-dihydroisoquinolin-4-amine?
The InChIKey is RQDAVWYGUJLPAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-11-10-7-12-6-8-4-2-3-5-9(8)10/h2-5,7,11-12H,6H2,1H3.
What are the key properties of N-methyl-1,2-dihydroisoquinolin-4-amine?
N-methyl-1,2-dihydroisoquinolin-4-amine has a molecular weight of 160.22 g/mol, XLogP of 1.31, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1,2-dihydroisoquinolin-4-amine is sourced from PubChem (CID 166944414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).