C10H12N2 — CID 166944414
N-methyl-1,2-dihydroisoquinolin-4-amine (PubChem CID 166944414) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is N-methyl-1,2-dihydroisoquinolin-4-amine.
| Compound Name | N-methyl-1,2-dihydroisoquinolin-4-amine |
|---|---|
| PubChem CID | 166944414 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | N-methyl-1,2-dihydroisoquinolin-4-amine |
| SMILES | CNC1=CNCc2ccccc21 |
| InChI | InChI=1S/C10H12N2/c1-11-10-7-12-6-8-4-2-3-5-9(8)10/h2-5,7,11-12H,6H2,1H3 |
| InChIKey | RQDAVWYGUJLPAT-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |