C20H29N3 — CID 155745422
ethane;(11Z)-11-N-methyl-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine (PubChem CID 155745422) has the molecular formula C20H29N3 and a molecular weight of 311.47 g/mol. Its IUPAC name is ethane;(11Z)-11-N-methyl-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine.
| Compound Name | ethane;(11Z)-11-N-methyl-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine |
|---|---|
| PubChem CID | 155745422 |
| Molecular Formula | C20H29N3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | ethane;(11Z)-11-N-methyl-5,6-dihydrobenzo[c][1]benzazocine-11,12-diamine |
| SMILES | CC.CC.CN/C1=C(\N)c2ccccc2NCc2ccccc21 |
| InChI | InChI=1S/C16H17N3.2C2H6/c1-18-16-12-7-3-2-6-11(12)10-19-14-9-5-4-8-13(14)15(16)17;2*1-2/h2-9,18-19H,10,17H2,1H3;2*1-2H3/b16-15-;; |
| InChIKey | MLBWKEDEKBGHDV-NDXGFPCWSA-N |
| XLogP | 4.67 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|