C11H15N — CID 178059907
ethane;3-methylidene-1,2-dihydroisoindole (PubChem CID 178059907) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is ethane;3-methylidene-1,2-dihydroisoindole.
| Compound Name | ethane;3-methylidene-1,2-dihydroisoindole |
|---|---|
| PubChem CID | 178059907 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | ethane;3-methylidene-1,2-dihydroisoindole |
| SMILES | C=C1NCc2ccccc21.CC |
| InChI | InChI=1S/C9H9N.C2H6/c1-7-9-5-3-2-4-8(9)6-10-7;1-2/h2-5,10H,1,6H2;1-2H3 |
| InChIKey | NYFZNCJLZOYHQS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |