C15H21N — CID 118583792
3,4-di(propan-2-yl)-1,2-dihydroisoquinoline (PubChem CID 118583792) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 3,4-di(propan-2-yl)-1,2-dihydroisoquinoline.
| Compound Name | 3,4-di(propan-2-yl)-1,2-dihydroisoquinoline |
|---|---|
| PubChem CID | 118583792 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 3,4-di(propan-2-yl)-1,2-dihydroisoquinoline |
| SMILES | CC(C)C1=C(C(C)C)c2ccccc2CN1 |
| InChI | InChI=1S/C15H21N/c1-10(2)14-13-8-6-5-7-12(13)9-16-15(14)11(3)4/h5-8,10-11,16H,9H2,1-4H3 |
| InChIKey | RQEBVIKQQUWQNX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |