About 3,4-di(propan-2-yl)-1,2-dihydroisoquinoline
3,4-di(propan-2-yl)-1,2-dihydroisoquinoline (PubChem CID 118583792) has the molecular formula C15H21N
and a molecular weight of 215.34 g/mol. Its IUPAC name is 3,4-di(propan-2-yl)-1,2-dihydroisoquinoline.
Molecular Properties
| Compound Name | 3,4-di(propan-2-yl)-1,2-dihydroisoquinoline |
| PubChem CID | 118583792 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 3,4-di(propan-2-yl)-1,2-dihydroisoquinoline |
| SMILES | CC(C)C1=C(C(C)C)c2ccccc2CN1 |
| InChI | InChI=1S/C15H21N/c1-10(2)14-13-8-6-5-7-12(13)9-16-15(14)11(3)4/h5-8,10-11,16H,9H2,1-4H3 |
| InChIKey | RQEBVIKQQUWQNX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-di(propan-2-yl)-1,2-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-di(propan-2-yl)-1,2-dihydroisoquinoline?
The IUPAC name of 3,4-di(propan-2-yl)-1,2-dihydroisoquinoline (CID 118583792) is 3,4-di(propan-2-yl)-1,2-dihydroisoquinoline.
What is the SMILES notation for 3,4-di(propan-2-yl)-1,2-dihydroisoquinoline?
The canonical SMILES for 3,4-di(propan-2-yl)-1,2-dihydroisoquinoline is CC(C)C1=C(C(C)C)c2ccccc2CN1.
What is the InChIKey of 3,4-di(propan-2-yl)-1,2-dihydroisoquinoline?
The InChIKey is RQEBVIKQQUWQNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N/c1-10(2)14-13-8-6-5-7-12(13)9-16-15(14)11(3)4/h5-8,10-11,16H,9H2,1-4H3.
What are the key properties of 3,4-di(propan-2-yl)-1,2-dihydroisoquinoline?
3,4-di(propan-2-yl)-1,2-dihydroisoquinoline has a molecular weight of 215.34 g/mol, XLogP of 3.81, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-di(propan-2-yl)-1,2-dihydroisoquinoline is sourced from PubChem (CID 118583792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).