C24H31N — CID 168786359
(11Z)-5,11,12-tri(propan-2-yl)-6H-benzo[c][1]benzazocine (PubChem CID 168786359) has the molecular formula C24H31N and a molecular weight of 333.52 g/mol. Its IUPAC name is (11Z)-5,11,12-tri(propan-2-yl)-6H-benzo[c][1]benzazocine.
| Compound Name | (11Z)-5,11,12-tri(propan-2-yl)-6H-benzo[c][1]benzazocine |
|---|---|
| PubChem CID | 168786359 |
| Molecular Formula | C24H31N |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | (11Z)-5,11,12-tri(propan-2-yl)-6H-benzo[c][1]benzazocine |
| SMILES | CC(C)/C1=C(\C(C)C)c2ccccc2N(C(C)C)Cc2ccccc21 |
| InChI | InChI=1S/C24H31N/c1-16(2)23-20-12-8-7-11-19(20)15-25(18(5)6)22-14-10-9-13-21(22)24(23)17(3)4/h7-14,16-18H,15H2,1-6H3/b24-23- |
| InChIKey | BKUBNHQSCIDQKQ-VHXPQNKSSA-N |
| XLogP | 6.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|