C14H21NO — CID 142243326
ethane;1-propan-2-yl-2,4-dihydroquinolin-3-one (PubChem CID 142243326) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is ethane;1-propan-2-yl-2,4-dihydroquinolin-3-one.
| Compound Name | ethane;1-propan-2-yl-2,4-dihydroquinolin-3-one |
|---|---|
| PubChem CID | 142243326 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | ethane;1-propan-2-yl-2,4-dihydroquinolin-3-one |
| SMILES | CC.CC(C)N1CC(=O)Cc2ccccc21 |
| InChI | InChI=1S/C12H15NO.C2H6/c1-9(2)13-8-11(14)7-10-5-3-4-6-12(10)13;1-2/h3-6,9H,7-8H2,1-2H3;1-2H3 |
| InChIKey | CMRDCHKYICPPIR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |