About 1-bromo-2,4-dihydroquinolin-3-one
1-bromo-2,4-dihydroquinolin-3-one (PubChem CID 141048465) has the molecular formula C9H8BrNO
and a molecular weight of 226.07 g/mol. Its IUPAC name is 1-bromo-2,4-dihydroquinolin-3-one.
Molecular Properties
| Compound Name | 1-bromo-2,4-dihydroquinolin-3-one |
| PubChem CID | 141048465 |
| Molecular Formula | C9H8BrNO |
| Molecular Weight | 226.07 g/mol |
| Exact Mass | 224.98 |
| IUPAC Name | 1-bromo-2,4-dihydroquinolin-3-one |
| SMILES | O=C1Cc2ccccc2N(Br)C1 |
| InChI | InChI=1S/C9H8BrNO/c10-11-6-8(12)5-7-3-1-2-4-9(7)11/h1-4H,5-6H2 |
| InChIKey | DTNNBYXYLMQJJL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.07 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2,4-dihydroquinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2,4-dihydroquinolin-3-one?
The IUPAC name of 1-bromo-2,4-dihydroquinolin-3-one (CID 141048465) is 1-bromo-2,4-dihydroquinolin-3-one.
What is the SMILES notation for 1-bromo-2,4-dihydroquinolin-3-one?
The canonical SMILES for 1-bromo-2,4-dihydroquinolin-3-one is O=C1Cc2ccccc2N(Br)C1.
What is the InChIKey of 1-bromo-2,4-dihydroquinolin-3-one?
The InChIKey is DTNNBYXYLMQJJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrNO/c10-11-6-8(12)5-7-3-1-2-4-9(7)11/h1-4H,5-6H2.
What are the key properties of 1-bromo-2,4-dihydroquinolin-3-one?
1-bromo-2,4-dihydroquinolin-3-one has a molecular weight of 226.07 g/mol, XLogP of 1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2,4-dihydroquinolin-3-one is sourced from PubChem (CID 141048465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).