About 9H-acridine-10-carbonyl chloride
9H-acridine-10-carbonyl chloride (PubChem CID 165358723) has the molecular formula C14H10ClNO
and a molecular weight of 243.69 g/mol. Its IUPAC name is 9H-acridine-10-carbonyl chloride.
Molecular Properties
| Compound Name | 9H-acridine-10-carbonyl chloride |
| PubChem CID | 165358723 |
| Molecular Formula | C14H10ClNO |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 9H-acridine-10-carbonyl chloride |
| SMILES | O=C(Cl)N1c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C14H10ClNO/c15-14(17)16-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)16/h1-8H,9H2 |
| InChIKey | BGQAOLJABIFQPK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 9H-acridine-10-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-acridine-10-carbonyl chloride?
The IUPAC name of 9H-acridine-10-carbonyl chloride (CID 165358723) is 9H-acridine-10-carbonyl chloride.
What is the SMILES notation for 9H-acridine-10-carbonyl chloride?
The canonical SMILES for 9H-acridine-10-carbonyl chloride is O=C(Cl)N1c2ccccc2Cc2ccccc21.
What is the InChIKey of 9H-acridine-10-carbonyl chloride?
The InChIKey is BGQAOLJABIFQPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClNO/c15-14(17)16-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)16/h1-8H,9H2.
What are the key properties of 9H-acridine-10-carbonyl chloride?
9H-acridine-10-carbonyl chloride has a molecular weight of 243.69 g/mol, XLogP of 4.09, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-acridine-10-carbonyl chloride is sourced from PubChem (CID 165358723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).