C17H16ClNO — CID 763093
(2R)-2-chloro-1-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-one (PubChem CID 763093) has the molecular formula C17H16ClNO and a molecular weight of 285.77 g/mol. Its IUPAC name is (2R)-2-chloro-1-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-one.
| Compound Name | (2R)-2-chloro-1-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-one |
|---|---|
| PubChem CID | 763093 |
| Molecular Formula | C17H16ClNO |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | (2R)-2-chloro-1-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propan-1-one |
| SMILES | C[C@@H](Cl)C(=O)N1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C17H16ClNO/c1-12(18)17(20)19-15-8-4-2-6-13(15)10-11-14-7-3-5-9-16(14)19/h2-9,12H,10-11H2,1H3/t12-/m1/s1 |
| InChIKey | DFFNQNMWXYFKSF-GFCCVEGCSA-N |
| XLogP | 4.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|