C17H17NO2 — CID 8548710
(2R)-2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propanoic acid (PubChem CID 8548710) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is (2R)-2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propanoic acid.
| Compound Name | (2R)-2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propanoic acid |
|---|---|
| PubChem CID | 8548710 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (2R)-2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propanoic acid |
| SMILES | C[C@H](C(=O)O)N1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C17H17NO2/c1-12(17(19)20)18-15-8-4-2-6-13(15)10-11-14-7-3-5-9-16(14)18/h2-9,12H,10-11H2,1H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | SGBLIUHACLSMSV-GFCCVEGCSA-N |
| XLogP | 3.40 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |