C12H11NO4 — CID 43123754
2-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid (PubChem CID 43123754) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 2-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid.
| Compound Name | 2-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid |
|---|---|
| PubChem CID | 43123754 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 2-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid |
| SMILES | CC(C(=O)O)N1C(=O)Cc2ccccc2C1=O |
| InChI | InChI=1S/C12H11NO4/c1-7(12(16)17)13-10(14)6-8-4-2-3-5-9(8)11(13)15/h2-5,7H,6H2,1H3,(H,16,17) |
| InChIKey | IRCPDGXNYDOSJH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|